C23H30FN5O3 — CID 66682867
5-fluoro-N-[(3-methylphenyl)methylideneamino]-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine (PubChem CID 66682867) has the molecular formula C23H30FN5O3 and a molecular weight of 443.52 g/mol. Its IUPAC name is 5-fluoro-N-[(3-methylphenyl)methylideneamino]-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine.
| Compound Name | 5-fluoro-N-[(3-methylphenyl)methylideneamino]-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 66682867 |
| Molecular Formula | C23H30FN5O3 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 5-fluoro-N-[(3-methylphenyl)methylideneamino]-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine |
| SMILES | Cc1cccc(C=NNc2cc(N3CCOCC3)c(F)c(OCCN3CCOCC3)n2)c1 |
| InChI | InChI=1S/C23H30FN5O3/c1-18-3-2-4-19(15-18)17-25-27-21-16-20(29-8-12-31-13-9-29)22(24)23(26-21)32-14-7-28-5-10-30-11-6-28/h2-4,15-17H,5-14H2,1H3,(H,26,27) |
| InChIKey | ZNGNFCDNYABSHD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|