C23H29F2N5O3 — CID 11178686
3,5-difluoro-N-[(E)-(3-methylphenyl)methylideneamino]-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-4-amine (PubChem CID 11178686) has the molecular formula C23H29F2N5O3 and a molecular weight of 461.51 g/mol. Its IUPAC name is 3,5-difluoro-N-[(E)-(3-methylphenyl)methylideneamino]-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-4-amine.
| Compound Name | 3,5-difluoro-N-[(E)-(3-methylphenyl)methylideneamino]-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-4-amine |
|---|---|
| PubChem CID | 11178686 |
| Molecular Formula | C23H29F2N5O3 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 3,5-difluoro-N-[(E)-(3-methylphenyl)methylideneamino]-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-4-amine |
| SMILES | Cc1cccc(/C=N/Nc2c(F)c(OCCN3CCOCC3)nc(N3CCOCC3)c2F)c1 |
| InChI | InChI=1S/C23H29F2N5O3/c1-17-3-2-4-18(15-17)16-26-28-21-19(24)22(30-8-12-32-13-9-30)27-23(20(21)25)33-14-7-29-5-10-31-11-6-29/h2-4,15-16H,5-14H2,1H3,(H,27,28)/b26-16+ |
| InChIKey | GPMSCGHUELXDAY-WGOQTCKBSA-N |
| XLogP | 2.66 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|