C25H25F2N5O4 — CID 66684269
3-[2-[[3,5-difluoro-6-morpholin-4-yl-4-[2-(naphthalen-2-ylmethylidene)hydrazinyl]-2-pyridinyl]oxy]ethyl]-1,3-oxazolidin-2-one (PubChem CID 66684269) has the molecular formula C25H25F2N5O4 and a molecular weight of 497.50 g/mol. Its IUPAC name is 3-[2-[[3,5-difluoro-6-morpholin-4-yl-4-[2-(naphthalen-2-ylmethylidene)hydrazinyl]-2-pyridinyl]oxy]ethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[[3,5-difluoro-6-morpholin-4-yl-4-[2-(naphthalen-2-ylmethylidene)hydrazinyl]-2-pyridinyl]oxy]ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 66684269 |
| Molecular Formula | C25H25F2N5O4 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 3-[2-[[3,5-difluoro-6-morpholin-4-yl-4-[2-(naphthalen-2-ylmethylidene)hydrazinyl]-2-pyridinyl]oxy]ethyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1CCOc1nc(N2CCOCC2)c(F)c(NN=Cc2ccc3ccccc3c2)c1F |
| InChI | InChI=1S/C25H25F2N5O4/c26-20-22(30-28-16-17-5-6-18-3-1-2-4-19(18)15-17)21(27)24(29-23(20)31-7-11-34-12-8-31)35-13-9-32-10-14-36-25(32)33/h1-6,15-16H,7-14H2,(H,29,30) |
| InChIKey | TUIJNWCTJXGCJG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_naphth_A(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|