C20H28N6O2 — CID 58060620
4-methyl-2-[[[6-[2-(methylamino)ethoxy]-2-morpholin-4-ylpyrimidin-4-yl]methylideneamino]methyl]aniline (PubChem CID 58060620) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-methyl-2-[[[6-[2-(methylamino)ethoxy]-2-morpholin-4-ylpyrimidin-4-yl]methylideneamino]methyl]aniline.
| Compound Name | 4-methyl-2-[[[6-[2-(methylamino)ethoxy]-2-morpholin-4-ylpyrimidin-4-yl]methylideneamino]methyl]aniline |
|---|---|
| PubChem CID | 58060620 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 4-methyl-2-[[[6-[2-(methylamino)ethoxy]-2-morpholin-4-ylpyrimidin-4-yl]methylideneamino]methyl]aniline |
| SMILES | CNCCOc1cc(/C=N/Cc2cc(C)ccc2N)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H28N6O2/c1-15-3-4-18(21)16(11-15)13-23-14-17-12-19(28-8-5-22-2)25-20(24-17)26-6-9-27-10-7-26/h3-4,11-12,14,22H,5-10,13,21H2,1-2H3/b23-14+ |
| InChIKey | TWUJYJLDEPPIBM-OEAKJJBVSA-N |
| XLogP | 1.42 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|