C21H29N5O3 — CID 58060124
1-[6-[(2-amino-5-methylphenyl)methyliminomethyl]-2-morpholin-4-ylpyrimidin-4-yl]oxy-2-methylpropan-2-ol (PubChem CID 58060124) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 1-[6-[(2-amino-5-methylphenyl)methyliminomethyl]-2-morpholin-4-ylpyrimidin-4-yl]oxy-2-methylpropan-2-ol.
| Compound Name | 1-[6-[(2-amino-5-methylphenyl)methyliminomethyl]-2-morpholin-4-ylpyrimidin-4-yl]oxy-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 58060124 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 1-[6-[(2-amino-5-methylphenyl)methyliminomethyl]-2-morpholin-4-ylpyrimidin-4-yl]oxy-2-methylpropan-2-ol |
| SMILES | Cc1ccc(N)c(C/N=C/c2cc(OCC(C)(C)O)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C21H29N5O3/c1-15-4-5-18(22)16(10-15)12-23-13-17-11-19(29-14-21(2,3)27)25-20(24-17)26-6-8-28-9-7-26/h4-5,10-11,13,27H,6-9,12,14,22H2,1-3H3/b23-13+ |
| InChIKey | SCBSDZMTOJVYCE-YDZHTSKRSA-N |
| XLogP | 1.97 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|