C26H41N5O4Si — CID 68517177
1-[6-[2-[tert-butyl(dimethyl)silyl]oxy-2-methylpropoxy]-2-morpholin-4-ylpyrimidin-4-yl]-3-(3-methylphenyl)urea (PubChem CID 68517177) has the molecular formula C26H41N5O4Si and a molecular weight of 515.73 g/mol. Its IUPAC name is 1-[6-[2-[tert-butyl(dimethyl)silyl]oxy-2-methylpropoxy]-2-morpholin-4-ylpyrimidin-4-yl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[6-[2-[tert-butyl(dimethyl)silyl]oxy-2-methylpropoxy]-2-morpholin-4-ylpyrimidin-4-yl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 68517177 |
| Molecular Formula | C26H41N5O4Si |
| Molecular Weight | 515.73 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 1-[6-[2-[tert-butyl(dimethyl)silyl]oxy-2-methylpropoxy]-2-morpholin-4-ylpyrimidin-4-yl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2cc(OCC(C)(C)O[Si](C)(C)C(C)(C)C)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C26H41N5O4Si/c1-19-10-9-11-20(16-19)27-24(32)29-21-17-22(30-23(28-21)31-12-14-33-15-13-31)34-18-26(5,6)35-36(7,8)25(2,3)4/h9-11,16-17H,12-15,18H2,1-8H3,(H2,27,28,29,30,32) |
| InChIKey | NFRXBCGBZLLTEI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.73 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|