C22H30N6O4 — CID 11711913
1-(3-methylphenyl)-3-[2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]urea (PubChem CID 11711913) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]urea.
| Compound Name | 1-(3-methylphenyl)-3-[2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 11711913 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 1-(3-methylphenyl)-3-[2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]urea |
| SMILES | Cc1cccc(NC(=O)Nc2cc(OCCN3CCOCC3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C22H30N6O4/c1-17-3-2-4-18(15-17)23-22(29)25-19-16-20(32-14-7-27-5-10-30-11-6-27)26-21(24-19)28-8-12-31-13-9-28/h2-4,15-16H,5-14H2,1H3,(H2,23,24,25,26,29) |
| InChIKey | WWWAMEUGIUGCKH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |