C25H35N7O4 — CID 87482089
N-[3-[(Z)-N-(dimethylamino)-C-methylcarbonimidoyl]phenyl]-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidine-4-carboxamide (PubChem CID 87482089) has the molecular formula C25H35N7O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-[3-[(Z)-N-(dimethylamino)-C-methylcarbonimidoyl]phenyl]-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidine-4-carboxamide.
| Compound Name | N-[3-[(Z)-N-(dimethylamino)-C-methylcarbonimidoyl]phenyl]-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 87482089 |
| Molecular Formula | C25H35N7O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | N-[3-[(Z)-N-(dimethylamino)-C-methylcarbonimidoyl]phenyl]-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidine-4-carboxamide |
| SMILES | C/C(=N/N(C)C)c1cccc(NC(=O)c2cc(OCCN3CCOCC3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C25H35N7O4/c1-19(29-30(2)3)20-5-4-6-21(17-20)26-24(33)22-18-23(36-16-9-31-7-12-34-13-8-31)28-25(27-22)32-10-14-35-15-11-32/h4-6,17-18H,7-16H2,1-3H3,(H,26,33)/b29-19- |
| InChIKey | NEWSCIQZYUGTLN-CEUNXORHSA-N |
| XLogP | 1.56 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|