C22H27N7O4 — CID 59258635
1-(3-cyanophenyl)-3-[2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]urea (PubChem CID 59258635) has the molecular formula C22H27N7O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 59258635 |
| Molecular Formula | C22H27N7O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]urea |
| SMILES | N#Cc1cccc(NC(=O)Nc2cc(OCCN3CCOCC3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C22H27N7O4/c23-16-17-2-1-3-18(14-17)24-22(30)26-19-15-20(33-13-6-28-4-9-31-10-5-28)27-21(25-19)29-7-11-32-12-8-29/h1-3,14-15H,4-13H2,(H2,24,25,26,27,30) |
| InChIKey | DQZCXAUXAZVBIO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |