C20H28N6O2 — CID 87089450
2-[4-[(Z)-C-(3,4-dimethylphenyl)carbonohydrazonoyl]-6-morpholin-4-ylpyrimidin-2-yl]oxy-N-methylethanamine (PubChem CID 87089450) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[4-[(Z)-C-(3,4-dimethylphenyl)carbonohydrazonoyl]-6-morpholin-4-ylpyrimidin-2-yl]oxy-N-methylethanamine.
| Compound Name | 2-[4-[(Z)-C-(3,4-dimethylphenyl)carbonohydrazonoyl]-6-morpholin-4-ylpyrimidin-2-yl]oxy-N-methylethanamine |
|---|---|
| PubChem CID | 87089450 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-[4-[(Z)-C-(3,4-dimethylphenyl)carbonohydrazonoyl]-6-morpholin-4-ylpyrimidin-2-yl]oxy-N-methylethanamine |
| SMILES | CNCCOc1nc(/C(=N\N)c2ccc(C)c(C)c2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H28N6O2/c1-14-4-5-16(12-15(14)2)19(25-21)17-13-18(26-7-10-27-11-8-26)24-20(23-17)28-9-6-22-3/h4-5,12-13,22H,6-11,21H2,1-3H3/b25-19- |
| InChIKey | FXXZHDNHZAHFMU-PLRJNAJWSA-N |
| XLogP | 1.24 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|