C18H26N6O3 — CID 87089565
2-[4-[(E)-C-(4,5-dimethylfuran-2-yl)carbonohydrazonoyl]-6-morpholin-4-ylpyrimidin-2-yl]oxy-N-methylethanamine (PubChem CID 87089565) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is 2-[4-[(E)-C-(4,5-dimethylfuran-2-yl)carbonohydrazonoyl]-6-morpholin-4-ylpyrimidin-2-yl]oxy-N-methylethanamine.
| Compound Name | 2-[4-[(E)-C-(4,5-dimethylfuran-2-yl)carbonohydrazonoyl]-6-morpholin-4-ylpyrimidin-2-yl]oxy-N-methylethanamine |
|---|---|
| PubChem CID | 87089565 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2-[4-[(E)-C-(4,5-dimethylfuran-2-yl)carbonohydrazonoyl]-6-morpholin-4-ylpyrimidin-2-yl]oxy-N-methylethanamine |
| SMILES | CNCCOc1nc(/C(=N\N)c2cc(C)c(C)o2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H26N6O3/c1-12-10-15(27-13(12)2)17(23-19)14-11-16(24-5-8-25-9-6-24)22-18(21-14)26-7-4-20-3/h10-11,20H,4-9,19H2,1-3H3/b23-17+ |
| InChIKey | PPYQVWGWBVZSEZ-HAVVHWLPSA-N |
| XLogP | 0.83 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|