C22H31N5O — CID 89358315
4-(dipropylamino)-N,N-dimethyl-6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]pyridine-2-carboxamide (PubChem CID 89358315) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-(dipropylamino)-N,N-dimethyl-6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]pyridine-2-carboxamide.
| Compound Name | 4-(dipropylamino)-N,N-dimethyl-6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89358315 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 4-(dipropylamino)-N,N-dimethyl-6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]pyridine-2-carboxamide |
| SMILES | CCCN(CCC)c1cc(N/N=C/c2cccc(C)c2)nc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C22H31N5O/c1-6-11-27(12-7-2)19-14-20(22(28)26(4)5)24-21(15-19)25-23-16-18-10-8-9-17(3)13-18/h8-10,13-16H,6-7,11-12H2,1-5H3,(H,24,25)/b23-16+ |
| InChIKey | ZUVVWFXPTOMKHM-XQNSMLJCSA-N |
| XLogP | 4.16 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|