C27H37N5O2 — CID 11190459
6-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethoxy]-N-[(E)-(3-methylphenyl)methylideneamino]-4-morpholin-4-ylpyridin-2-amine (PubChem CID 11190459) has the molecular formula C27H37N5O2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 6-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethoxy]-N-[(E)-(3-methylphenyl)methylideneamino]-4-morpholin-4-ylpyridin-2-amine.
| Compound Name | 6-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethoxy]-N-[(E)-(3-methylphenyl)methylideneamino]-4-morpholin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 11190459 |
| Molecular Formula | C27H37N5O2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | 6-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethoxy]-N-[(E)-(3-methylphenyl)methylideneamino]-4-morpholin-4-ylpyridin-2-amine |
| SMILES | Cc1cccc(/C=N/Nc2cc(N3CCOCC3)cc(OCCN3CCC4CCCCC43)n2)c1 |
| InChI | InChI=1S/C27H37N5O2/c1-21-5-4-6-22(17-21)20-28-30-26-18-24(31-11-14-33-15-12-31)19-27(29-26)34-16-13-32-10-9-23-7-2-3-8-25(23)32/h4-6,17-20,23,25H,2-3,7-16H2,1H3,(H,29,30)/b28-20+ |
| InChIKey | YQWGIDFYRYUISQ-VFCFBJKWSA-N |
| XLogP | 4.32 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|