C27H36N4O4 — CID 11431589
cyclohexyl 4-[[6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-2-pyridinyl]oxy]butanoate (PubChem CID 11431589) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is cyclohexyl 4-[[6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-2-pyridinyl]oxy]butanoate.
| Compound Name | cyclohexyl 4-[[6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-2-pyridinyl]oxy]butanoate |
|---|---|
| PubChem CID | 11431589 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | cyclohexyl 4-[[6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-2-pyridinyl]oxy]butanoate |
| SMILES | Cc1cccc(/C=N/Nc2cc(N3CCOCC3)cc(OCCCC(=O)OC3CCCCC3)n2)c1 |
| InChI | InChI=1S/C27H36N4O4/c1-21-7-5-8-22(17-21)20-28-30-25-18-23(31-12-15-33-16-13-31)19-26(29-25)34-14-6-11-27(32)35-24-9-3-2-4-10-24/h5,7-8,17-20,24H,2-4,6,9-16H2,1H3,(H,29,30)/b28-20+ |
| InChIKey | UJFSHXYBELDWHR-VFCFBJKWSA-N |
| XLogP | 4.71 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|