C28H31F3N6O3 — CID 66841104
[2-methyl-1-[4-[2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]propan-2-yl] N-[4-(trifluoromethyl)phenyl]carbamate (PubChem CID 66841104) has the molecular formula C28H31F3N6O3 and a molecular weight of 556.59 g/mol. Its IUPAC name is [2-methyl-1-[4-[2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]propan-2-yl] N-[4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [2-methyl-1-[4-[2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]propan-2-yl] N-[4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 66841104 |
| Molecular Formula | C28H31F3N6O3 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | [2-methyl-1-[4-[2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]propan-2-yl] N-[4-(trifluoromethyl)phenyl]carbamate |
| SMILES | Cc1cccc(C=NNc2cc(N3CCOCC3)nc(CC(C)(C)OC(=O)Nc3ccc(C(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C28H31F3N6O3/c1-19-5-4-6-20(15-19)18-32-36-23-16-25(37-11-13-39-14-12-37)35-24(34-23)17-27(2,3)40-26(38)33-22-9-7-21(8-10-22)28(29,30)31/h4-10,15-16,18H,11-14,17H2,1-3H3,(H,33,38)(H,34,35,36) |
| InChIKey | KECQTLLVPHOBLQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|