C20H26N6O2 — CID 135641493
4-[(E)-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)hydrazinylidene]methyl]-2-methoxyphenol (PubChem CID 135641493) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 4-[(E)-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)hydrazinylidene]methyl]-2-methoxyphenol.
| Compound Name | 4-[(E)-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)hydrazinylidene]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 135641493 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 4-[(E)-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)hydrazinylidene]methyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=N/Nc2cc(N3CCCC3)nc(N3CCCC3)n2)ccc1O |
| InChI | InChI=1S/C20H26N6O2/c1-28-17-12-15(6-7-16(17)27)14-21-24-18-13-19(25-8-2-3-9-25)23-20(22-18)26-10-4-5-11-26/h6-7,12-14,27H,2-5,8-11H2,1H3,(H,22,23,24)/b21-14+ |
| InChIKey | ARRVQULVAQZHGG-KGENOOAVSA-N |
| XLogP | 2.84 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|