C27H32N6O3S — CID 3869055
[4-[[[2,6-di(piperidin-1-yl)pyrimidin-4-yl]hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 3869055) has the molecular formula C27H32N6O3S and a molecular weight of 520.66 g/mol. Its IUPAC name is [4-[[[2,6-di(piperidin-1-yl)pyrimidin-4-yl]hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[[[2,6-di(piperidin-1-yl)pyrimidin-4-yl]hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3869055 |
| Molecular Formula | C27H32N6O3S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | [4-[[[2,6-di(piperidin-1-yl)pyrimidin-4-yl]hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(C=NNc2cc(N3CCCCC3)nc(N3CCCCC3)n2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C27H32N6O3S/c1-35-22-17-20(10-11-21(22)36-26(34)23-9-8-16-37-23)19-28-31-24-18-25(32-12-4-2-5-13-32)30-27(29-24)33-14-6-3-7-15-33/h8-11,16-19H,2-7,12-15H2,1H3,(H,29,30,31) |
| InChIKey | WHAKKCNVXHNXHU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|