C23H28N5OP — CID 44515823
4-diphenylphosphanyl-N,N-diethyl-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 44515823) has the molecular formula C23H28N5OP and a molecular weight of 421.49 g/mol. Its IUPAC name is 4-diphenylphosphanyl-N,N-diethyl-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-diphenylphosphanyl-N,N-diethyl-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 44515823 |
| Molecular Formula | C23H28N5OP |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 4-diphenylphosphanyl-N,N-diethyl-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1nc(N2CCOCC2)nc(P(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C23H28N5OP/c1-3-27(4-2)21-24-22(28-15-17-29-18-16-28)26-23(25-21)30(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14H,3-4,15-18H2,1-2H3 |
| InChIKey | STTVPXBHLIPTLQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|