C21H22N6O2 — CID 67443051
3-(4-methylphenyl)-1-(4-morpholin-4-yl-1,3,5-triazin-2-yl)-1-phenylurea (PubChem CID 67443051) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1-(4-morpholin-4-yl-1,3,5-triazin-2-yl)-1-phenylurea.
| Compound Name | 3-(4-methylphenyl)-1-(4-morpholin-4-yl-1,3,5-triazin-2-yl)-1-phenylurea |
|---|---|
| PubChem CID | 67443051 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3-(4-methylphenyl)-1-(4-morpholin-4-yl-1,3,5-triazin-2-yl)-1-phenylurea |
| SMILES | Cc1ccc(NC(=O)N(c2ccccc2)c2ncnc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C21H22N6O2/c1-16-7-9-17(10-8-16)24-21(28)27(18-5-3-2-4-6-18)20-23-15-22-19(25-20)26-11-13-29-14-12-26/h2-10,15H,11-14H2,1H3,(H,24,28) |
| InChIKey | VBRIRVJGBSKIKL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |