C17H22N6O2 — CID 67441955
1-(4-morpholin-4-yl-1,3,5-triazin-2-yl)-3-phenyl-1-propan-2-ylurea (PubChem CID 67441955) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-(4-morpholin-4-yl-1,3,5-triazin-2-yl)-3-phenyl-1-propan-2-ylurea.
| Compound Name | 1-(4-morpholin-4-yl-1,3,5-triazin-2-yl)-3-phenyl-1-propan-2-ylurea |
|---|---|
| PubChem CID | 67441955 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-(4-morpholin-4-yl-1,3,5-triazin-2-yl)-3-phenyl-1-propan-2-ylurea |
| SMILES | CC(C)N(C(=O)Nc1ccccc1)c1ncnc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H22N6O2/c1-13(2)23(17(24)20-14-6-4-3-5-7-14)16-19-12-18-15(21-16)22-8-10-25-11-9-22/h3-7,12-13H,8-11H2,1-2H3,(H,20,24) |
| InChIKey | OOHYORKNGLOLGK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |