C12H13N5O — CID 141107060
4-(4-pyridin-2-yl-1,3,5-triazin-2-yl)morpholine (PubChem CID 141107060) has the molecular formula C12H13N5O and a molecular weight of 243.27 g/mol. Its IUPAC name is 4-(4-pyridin-2-yl-1,3,5-triazin-2-yl)morpholine.
| Compound Name | 4-(4-pyridin-2-yl-1,3,5-triazin-2-yl)morpholine |
|---|---|
| PubChem CID | 141107060 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 4-(4-pyridin-2-yl-1,3,5-triazin-2-yl)morpholine |
| SMILES | c1ccc(-c2ncnc(N3CCOCC3)n2)nc1 |
| InChI | InChI=1S/C12H13N5O/c1-2-4-13-10(3-1)11-14-9-15-12(16-11)17-5-7-18-8-6-17/h1-4,9H,5-8H2 |
| InChIKey | GVKVPKPEGHQXCA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |