C20H20N4O2 — CID 58137077
4-[6-(phenoxymethyl)-2-pyridin-2-ylpyrimidin-4-yl]morpholine (PubChem CID 58137077) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 4-[6-(phenoxymethyl)-2-pyridin-2-ylpyrimidin-4-yl]morpholine.
| Compound Name | 4-[6-(phenoxymethyl)-2-pyridin-2-ylpyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 58137077 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4-[6-(phenoxymethyl)-2-pyridin-2-ylpyrimidin-4-yl]morpholine |
| SMILES | c1ccc(OCc2cc(N3CCOCC3)nc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C20H20N4O2/c1-2-6-17(7-3-1)26-15-16-14-19(24-10-12-25-13-11-24)23-20(22-16)18-8-4-5-9-21-18/h1-9,14H,10-13,15H2 |
| InChIKey | USIXHXOJMBSZBK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |