About 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine
4-pyrido[3,2-d]pyrimidin-2-ylmorpholine (PubChem CID 67130702) has the molecular formula C11H12N4O
and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine.
Molecular Properties
| Compound Name | 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine |
| PubChem CID | 67130702 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine |
| SMILES | c1cnc2cnc(N3CCOCC3)nc2c1 |
| InChI | InChI=1S/C11H12N4O/c1-2-9-10(12-3-1)8-13-11(14-9)15-4-6-16-7-5-15/h1-3,8H,4-7H2 |
| InChIKey | ZKFBCISGDPZMKS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine?
The IUPAC name of 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine (CID 67130702) is 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine.
What is the SMILES notation for 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine?
The canonical SMILES for 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine is c1cnc2cnc(N3CCOCC3)nc2c1.
What is the InChIKey of 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine?
The InChIKey is ZKFBCISGDPZMKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O/c1-2-9-10(12-3-1)8-13-11(14-9)15-4-6-16-7-5-15/h1-3,8H,4-7H2.
What are the key properties of 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine?
4-pyrido[3,2-d]pyrimidin-2-ylmorpholine has a molecular weight of 216.24 g/mol, XLogP of 0.86, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine is sourced from PubChem (CID 67130702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).