C11H12N4O — CID 67130702
4-pyrido[3,2-d]pyrimidin-2-ylmorpholine (PubChem CID 67130702) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine.
| Compound Name | 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine |
|---|---|
| PubChem CID | 67130702 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 4-pyrido[3,2-d]pyrimidin-2-ylmorpholine |
| SMILES | c1cnc2cnc(N3CCOCC3)nc2c1 |
| InChI | InChI=1S/C11H12N4O/c1-2-9-10(12-3-1)8-13-11(14-9)15-4-6-16-7-5-15/h1-3,8H,4-7H2 |
| InChIKey | ZKFBCISGDPZMKS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |