C18H25N7O3 — CID 2190720
1-[2-[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]oxy]ethyl]-3-phenylurea (PubChem CID 2190720) has the molecular formula C18H25N7O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-[2-[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]oxy]ethyl]-3-phenylurea.
| Compound Name | 1-[2-[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]oxy]ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 2190720 |
| Molecular Formula | C18H25N7O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 1-[2-[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]oxy]ethyl]-3-phenylurea |
| SMILES | CN(C)c1nc(OCCNC(=O)Nc2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H25N7O3/c1-24(2)15-21-16(25-9-12-27-13-10-25)23-18(22-15)28-11-8-19-17(26)20-14-6-4-3-5-7-14/h3-7H,8-13H2,1-2H3,(H2,19,20,26) |
| InChIKey | PYSDDDLOLFMHOC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|