C15H20N6O2S — CID 3589759
1-[2-[[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]oxy]ethyl]-3-phenylurea (PubChem CID 3589759) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 1-[2-[[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]oxy]ethyl]-3-phenylurea.
| Compound Name | 1-[2-[[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]oxy]ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 3589759 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[2-[[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]oxy]ethyl]-3-phenylurea |
| SMILES | CSc1nc(OCCNC(=O)Nc2ccccc2)nc(N(C)C)n1 |
| InChI | InChI=1S/C15H20N6O2S/c1-21(2)12-18-14(20-15(19-12)24-3)23-10-9-16-13(22)17-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3,(H2,16,17,22) |
| InChIKey | SDXSDPAWVJAAKE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|