C15H21N7O2 — CID 34888408
1-[2-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]-3-(4-methylphenyl)urea (PubChem CID 34888408) has the molecular formula C15H21N7O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 1-[2-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[2-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 34888408 |
| Molecular Formula | C15H21N7O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 1-[2-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCCOc2nc(N)nc(N(C)C)n2)cc1 |
| InChI | InChI=1S/C15H21N7O2/c1-10-4-6-11(7-5-10)18-14(23)17-8-9-24-15-20-12(16)19-13(21-15)22(2)3/h4-7H,8-9H2,1-3H3,(H2,17,18,23)(H2,16,19,20,21) |
| InChIKey | CWYZZWBZOLXTQI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|