C11H20N6O2 — CID 2190946
N-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]acetamide (PubChem CID 2190946) has the molecular formula C11H20N6O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]acetamide.
| Compound Name | N-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]acetamide |
|---|---|
| PubChem CID | 2190946 |
| Molecular Formula | C11H20N6O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOc1nc(N(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H20N6O2/c1-8(18)12-6-7-19-11-14-9(16(2)3)13-10(15-11)17(4)5/h6-7H2,1-5H3,(H,12,18) |
| InChIKey | OIITUCNQKIEKGP-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|