C16H21Cl2N7O2 — CID 27396154
1-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 27396154) has the molecular formula C16H21Cl2N7O2 and a molecular weight of 414.30 g/mol. Its IUPAC name is 1-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 27396154 |
| Molecular Formula | C16H21Cl2N7O2 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 1-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | CN(C)c1nc(OCCNC(=O)Nc2ccc(Cl)c(Cl)c2)nc(N(C)C)n1 |
| InChI | InChI=1S/C16H21Cl2N7O2/c1-24(2)13-21-14(25(3)4)23-16(22-13)27-8-7-19-15(26)20-10-5-6-11(17)12(18)9-10/h5-6,9H,7-8H2,1-4H3,(H2,19,20,26) |
| InChIKey | CURVWQMKOFBPMS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|