C14H18Cl2N2O2 — CID 17466807
1-[3-(cyclopropylmethoxy)propyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 17466807) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)propyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[3-(cyclopropylmethoxy)propyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 17466807 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)propyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(NCCCOCC1CC1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c15-12-5-4-11(8-13(12)16)18-14(19)17-6-1-7-20-9-10-2-3-10/h4-5,8,10H,1-3,6-7,9H2,(H2,17,18,19) |
| InChIKey | ZRABSWDMHVBCCD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|