C18H22N4O3 — CID 87044694
1-[3-(cyclopropylmethoxy)propyl]-3-(4-pyrimidin-2-yloxyphenyl)urea (PubChem CID 87044694) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)propyl]-3-(4-pyrimidin-2-yloxyphenyl)urea.
| Compound Name | 1-[3-(cyclopropylmethoxy)propyl]-3-(4-pyrimidin-2-yloxyphenyl)urea |
|---|---|
| PubChem CID | 87044694 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)propyl]-3-(4-pyrimidin-2-yloxyphenyl)urea |
| SMILES | O=C(NCCCOCC1CC1)Nc1ccc(Oc2ncccn2)cc1 |
| InChI | InChI=1S/C18H22N4O3/c23-17(19-11-2-12-24-13-14-3-4-14)22-15-5-7-16(8-6-15)25-18-20-9-1-10-21-18/h1,5-10,14H,2-4,11-13H2,(H2,19,22,23) |
| InChIKey | NJYAMQJALVNLPG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|