C22H31N7O4 — CID 44516005
1-[2-(methylamino)ethyl]-3-[4-[4-morpholin-4-yl-6-(oxan-4-yloxy)-1,3,5-triazin-2-yl]phenyl]urea (PubChem CID 44516005) has the molecular formula C22H31N7O4 and a molecular weight of 457.54 g/mol. Its IUPAC name is 1-[2-(methylamino)ethyl]-3-[4-[4-morpholin-4-yl-6-(oxan-4-yloxy)-1,3,5-triazin-2-yl]phenyl]urea.
| Compound Name | 1-[2-(methylamino)ethyl]-3-[4-[4-morpholin-4-yl-6-(oxan-4-yloxy)-1,3,5-triazin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 44516005 |
| Molecular Formula | C22H31N7O4 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 1-[2-(methylamino)ethyl]-3-[4-[4-morpholin-4-yl-6-(oxan-4-yloxy)-1,3,5-triazin-2-yl]phenyl]urea |
| SMILES | CNCCNC(=O)Nc1ccc(-c2nc(OC3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C22H31N7O4/c1-23-8-9-24-21(30)25-17-4-2-16(3-5-17)19-26-20(29-10-14-32-15-11-29)28-22(27-19)33-18-6-12-31-13-7-18/h2-5,18,23H,6-15H2,1H3,(H2,24,25,30) |
| InChIKey | ZADDEAYCIVHIFL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|