C21H22N6O2 — CID 67616912
1-[4-(oxan-4-ylamino)pyrimidin-2-yl]-1-phenyl-3-pyridin-4-ylurea (PubChem CID 67616912) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 1-[4-(oxan-4-ylamino)pyrimidin-2-yl]-1-phenyl-3-pyridin-4-ylurea.
| Compound Name | 1-[4-(oxan-4-ylamino)pyrimidin-2-yl]-1-phenyl-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 67616912 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-[4-(oxan-4-ylamino)pyrimidin-2-yl]-1-phenyl-3-pyridin-4-ylurea |
| SMILES | O=C(Nc1ccncc1)N(c1ccccc1)c1nccc(NC2CCOCC2)n1 |
| InChI | InChI=1S/C21H22N6O2/c28-21(25-16-6-11-22-12-7-16)27(18-4-2-1-3-5-18)20-23-13-8-19(26-20)24-17-9-14-29-15-10-17/h1-8,11-13,17H,9-10,14-15H2,(H,22,25,28)(H,23,24,26) |
| InChIKey | BAICIROYXDMTSQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |