C18H14N6O — CID 69025976
1-phenyl-3-pyridin-4-yl-1-(5H-pyrrolo[3,2-d]pyrimidin-2-yl)urea (PubChem CID 69025976) has the molecular formula C18H14N6O and a molecular weight of 330.35 g/mol. Its IUPAC name is 1-phenyl-3-pyridin-4-yl-1-(5H-pyrrolo[3,2-d]pyrimidin-2-yl)urea.
| Compound Name | 1-phenyl-3-pyridin-4-yl-1-(5H-pyrrolo[3,2-d]pyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 69025976 |
| Molecular Formula | C18H14N6O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-phenyl-3-pyridin-4-yl-1-(5H-pyrrolo[3,2-d]pyrimidin-2-yl)urea |
| SMILES | O=C(Nc1ccncc1)N(c1ccccc1)c1ncc2[nH]ccc2n1 |
| InChI | InChI=1S/C18H14N6O/c25-18(22-13-6-9-19-10-7-13)24(14-4-2-1-3-5-14)17-21-12-16-15(23-17)8-11-20-16/h1-12,20H,(H,19,22,25) |
| InChIKey | XSVHUOHWTDTTRR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |