C14H14N6O2 — CID 66593998
3-(2-hydroxyethyl)-1-phenyl-1-(1H-pyrazolo[3,4-d]pyrimidin-6-yl)urea (PubChem CID 66593998) has the molecular formula C14H14N6O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-1-phenyl-1-(1H-pyrazolo[3,4-d]pyrimidin-6-yl)urea.
| Compound Name | 3-(2-hydroxyethyl)-1-phenyl-1-(1H-pyrazolo[3,4-d]pyrimidin-6-yl)urea |
|---|---|
| PubChem CID | 66593998 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-(2-hydroxyethyl)-1-phenyl-1-(1H-pyrazolo[3,4-d]pyrimidin-6-yl)urea |
| SMILES | O=C(NCCO)N(c1ccccc1)c1ncc2cn[nH]c2n1 |
| InChI | InChI=1S/C14H14N6O2/c21-7-6-15-14(22)20(11-4-2-1-3-5-11)13-16-8-10-9-17-19-12(10)18-13/h1-5,8-9,21H,6-7H2,(H,15,22)(H,16,17,18,19) |
| InChIKey | IBGCVWJOWNUEDE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |