C19H16N4O — CID 59306221
1-(5-ethenylpyrimidin-2-yl)-1,3-diphenylurea (PubChem CID 59306221) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-(5-ethenylpyrimidin-2-yl)-1,3-diphenylurea.
| Compound Name | 1-(5-ethenylpyrimidin-2-yl)-1,3-diphenylurea |
|---|---|
| PubChem CID | 59306221 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-(5-ethenylpyrimidin-2-yl)-1,3-diphenylurea |
| SMILES | C=Cc1cnc(N(C(=O)Nc2ccccc2)c2ccccc2)nc1 |
| InChI | InChI=1S/C19H16N4O/c1-2-15-13-20-18(21-14-15)23(17-11-7-4-8-12-17)19(24)22-16-9-5-3-6-10-16/h2-14H,1H2,(H,22,24) |
| InChIKey | XIISMBNTQGZSGY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |