C19H26N2OSi — CID 21314542
1,3-diphenyl-1-triethylsilylurea (PubChem CID 21314542) has the molecular formula C19H26N2OSi and a molecular weight of 326.52 g/mol. Its IUPAC name is 1,3-diphenyl-1-triethylsilylurea.
| Compound Name | 1,3-diphenyl-1-triethylsilylurea |
|---|---|
| PubChem CID | 21314542 |
| Molecular Formula | C19H26N2OSi |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1,3-diphenyl-1-triethylsilylurea |
| SMILES | CC[Si](CC)(CC)N(C(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H26N2OSi/c1-4-23(5-2,6-3)21(18-15-11-8-12-16-18)19(22)20-17-13-9-7-10-14-17/h7-16H,4-6H2,1-3H3,(H,20,22) |
| InChIKey | ZSNWHUWUQPHFPR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|