C9H14N4O — CID 54267679
1,1-bis(methylamino)-3-phenylurea (PubChem CID 54267679) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 1,1-bis(methylamino)-3-phenylurea.
| Compound Name | 1,1-bis(methylamino)-3-phenylurea |
|---|---|
| PubChem CID | 54267679 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 1,1-bis(methylamino)-3-phenylurea |
| SMILES | CNN(NC)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C9H14N4O/c1-10-13(11-2)9(14)12-8-6-4-3-5-7-8/h3-7,10-11H,1-2H3,(H,12,14) |
| InChIKey | RHXDBOFUJLTINZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|