About N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide
N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide (PubChem CID 12864691) has the molecular formula C17H17N3O3
and a molecular weight of 311.34 g/mol. Its IUPAC name is N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide.
Molecular Properties
| Compound Name | N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide |
| PubChem CID | 12864691 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide |
| SMILES | CN(C(=O)CC(=O)Nc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H17N3O3/c1-20(17(23)19-14-10-6-3-7-11-14)16(22)12-15(21)18-13-8-4-2-5-9-13/h2-11H,12H2,1H3,(H,18,21)(H,19,23) |
| InChIKey | WOWMZIZHGZTATI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide?
The IUPAC name of N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide (CID 12864691) is N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide.
What is the SMILES notation for N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide?
The canonical SMILES for N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide is CN(C(=O)CC(=O)Nc1ccccc1)C(=O)Nc1ccccc1.
What is the InChIKey of N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide?
The InChIKey is WOWMZIZHGZTATI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O3/c1-20(17(23)19-14-10-6-3-7-11-14)16(22)12-15(21)18-13-8-4-2-5-9-13/h2-11H,12H2,1H3,(H,18,21)(H,19,23).
What are the key properties of N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide?
N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide has a molecular weight of 311.34 g/mol, XLogP of 2.71, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-phenyl-N'-(phenylcarbamoyl)propanediamide is sourced from PubChem (CID 12864691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).