C18H19N3O2 — CID 14709281
1-(6-methyl-5,6-dihydro-4H-1,3-oxazin-2-yl)-1,3-diphenylurea (PubChem CID 14709281) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-(6-methyl-5,6-dihydro-4H-1,3-oxazin-2-yl)-1,3-diphenylurea.
| Compound Name | 1-(6-methyl-5,6-dihydro-4H-1,3-oxazin-2-yl)-1,3-diphenylurea |
|---|---|
| PubChem CID | 14709281 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-(6-methyl-5,6-dihydro-4H-1,3-oxazin-2-yl)-1,3-diphenylurea |
| SMILES | CC1CCN=C(N(C(=O)Nc2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C18H19N3O2/c1-14-12-13-19-18(23-14)21(16-10-6-3-7-11-16)17(22)20-15-8-4-2-5-9-15/h2-11,14H,12-13H2,1H3,(H,20,22) |
| InChIKey | CFNLMDPERIIUIG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |