C17H17N3OS — CID 40577280
1-[(5R)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]-1,3-diphenylurea (PubChem CID 40577280) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-[(5R)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]-1,3-diphenylurea.
| Compound Name | 1-[(5R)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]-1,3-diphenylurea |
|---|---|
| PubChem CID | 40577280 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-[(5R)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]-1,3-diphenylurea |
| SMILES | C[C@@H]1CN=C(N(C(=O)Nc2ccccc2)c2ccccc2)S1 |
| InChI | InChI=1S/C17H17N3OS/c1-13-12-18-17(22-13)20(15-10-6-3-7-11-15)16(21)19-14-8-4-2-5-9-14/h2-11,13H,12H2,1H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | HSBQNSJYZKDWEL-CYBMUJFWSA-N |
| XLogP | 4.22 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |