C35H49BN2O7 — CID 153486057
dimethyl 4-[3-[[2-methyl-1-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]propyl]amino]cyclobutyl]oxybenzene-1,2-dicarboxylate (PubChem CID 153486057) has the molecular formula C35H49BN2O7 and a molecular weight of 620.60 g/mol. Its IUPAC name is dimethyl 4-[3-[[2-methyl-1-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]propyl]amino]cyclobutyl]oxybenzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[3-[[2-methyl-1-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]propyl]amino]cyclobutyl]oxybenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 153486057 |
| Molecular Formula | C35H49BN2O7 |
| Molecular Weight | 620.60 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | dimethyl 4-[3-[[2-methyl-1-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]propyl]amino]cyclobutyl]oxybenzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(OC2CC(NC(C(C)C)C3CCN(c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)CC3)C2)cc1C(=O)OC |
| InChI | InChI=1S/C35H49BN2O7/c1-22(2)31(37-25-19-28(20-25)43-27-13-14-29(32(39)41-7)30(21-27)33(40)42-8)23-15-17-38(18-16-23)26-11-9-24(10-12-26)36-44-34(3,4)35(5,6)45-36/h9-14,21-23,25,28,31,37H,15-20H2,1-8H3 |
| InChIKey | QJVZHMZBRJJJMZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|