C15H23BN2O5S — CID 156816664
2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylsulfamoyl]acetamide (PubChem CID 156816664) has the molecular formula C15H23BN2O5S and a molecular weight of 354.24 g/mol. Its IUPAC name is 2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylsulfamoyl]acetamide.
| Compound Name | 2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylsulfamoyl]acetamide |
|---|---|
| PubChem CID | 156816664 |
| Molecular Formula | C15H23BN2O5S |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylsulfamoyl]acetamide |
| SMILES | CC1(C)OB(c2cccc(CNS(=O)(=O)CC(N)=O)c2)OC1(C)C |
| InChI | InChI=1S/C15H23BN2O5S/c1-14(2)15(3,4)23-16(22-14)12-7-5-6-11(8-12)9-18-24(20,21)10-13(17)19/h5-8,18H,9-10H2,1-4H3,(H2,17,19) |
| InChIKey | DDLVJVASACMFCO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|