C18H24BN3O3 — CID 154815387
N-[(3-methylphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide (PubChem CID 154815387) has the molecular formula C18H24BN3O3 and a molecular weight of 341.22 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide.
| Compound Name | N-[(3-methylphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154815387 |
| Molecular Formula | C18H24BN3O3 |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-[(3-methylphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide |
| SMILES | Cc1cccc(CNC(=O)n2cc(B3OC(C)(C)C(C)(C)O3)cn2)c1 |
| InChI | InChI=1S/C18H24BN3O3/c1-13-7-6-8-14(9-13)10-20-16(23)22-12-15(11-21-22)19-24-17(2,3)18(4,5)25-19/h6-9,11-12H,10H2,1-5H3,(H,20,23) |
| InChIKey | YUPOUPPBDRXRSM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|