C18H24BN3O2 — CID 158035457
N-[(3-methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (PubChem CID 158035457) has the molecular formula C18H24BN3O2 and a molecular weight of 325.22 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine.
| Compound Name | N-[(3-methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 158035457 |
| Molecular Formula | C18H24BN3O2 |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | N-[(3-methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| SMILES | Cc1cccc(CNc2ncc(B3OC(C)(C)C(C)(C)O3)cn2)c1 |
| InChI | InChI=1S/C18H24BN3O2/c1-13-7-6-8-14(9-13)10-20-16-21-11-15(12-22-16)19-23-17(2,3)18(4,5)24-19/h6-9,11-12H,10H2,1-5H3,(H,20,21,22) |
| InChIKey | KQWNEIDMBGJISR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|