C24H33BN4O3 — CID 163443818
3-N-benzyl-5-methylpyridine-2,3-diamine;3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole (PubChem CID 163443818) has the molecular formula C24H33BN4O3 and a molecular weight of 436.37 g/mol. Its IUPAC name is 3-N-benzyl-5-methylpyridine-2,3-diamine;3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole.
| Compound Name | 3-N-benzyl-5-methylpyridine-2,3-diamine;3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 163443818 |
| Molecular Formula | C24H33BN4O3 |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 3-N-benzyl-5-methylpyridine-2,3-diamine;3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole |
| SMILES | Cc1cnc(N)c(NCc2ccccc2)c1.Cc1noc(C)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H15N3.C11H18BNO3/c1-10-7-12(13(14)16-8-10)15-9-11-5-3-2-4-6-11;1-7-9(8(2)14-13-7)12-15-10(3,4)11(5,6)16-12/h2-8,15H,9H2,1H3,(H2,14,16);1-6H3 |
| InChIKey | BAUJIKOGQPIHRW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|