C19H30BNO3 — CID 154669374
1-methyl-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]piperidine (PubChem CID 154669374) has the molecular formula C19H30BNO3 and a molecular weight of 331.26 g/mol. Its IUPAC name is 1-methyl-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]piperidine.
| Compound Name | 1-methyl-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]piperidine |
|---|---|
| PubChem CID | 154669374 |
| Molecular Formula | C19H30BNO3 |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-methyl-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]piperidine |
| SMILES | CN1CCC(OCc2cccc(B3OC(C)(C)C(C)(C)O3)c2)CC1 |
| InChI | InChI=1S/C19H30BNO3/c1-18(2)19(3,4)24-20(23-18)16-8-6-7-15(13-16)14-22-17-9-11-21(5)12-10-17/h6-8,13,17H,9-12,14H2,1-5H3 |
| InChIKey | PGHOLXGRFMOHLM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|