C19H29BFNO3 — CID 174110254
1-(3-fluoropropyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidine (PubChem CID 174110254) has the molecular formula C19H29BFNO3 and a molecular weight of 349.26 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidine.
| Compound Name | 1-(3-fluoropropyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidine |
|---|---|
| PubChem CID | 174110254 |
| Molecular Formula | C19H29BFNO3 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-(3-fluoropropyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidine |
| SMILES | CC1(C)OB(c2cccc(OC3CCN(CCCF)C3)c2)OC1(C)C |
| InChI | InChI=1S/C19H29BFNO3/c1-18(2)19(3,4)25-20(24-18)15-7-5-8-16(13-15)23-17-9-12-22(14-17)11-6-10-21/h5,7-8,13,17H,6,9-12,14H2,1-4H3 |
| InChIKey | FBXNWFHPAMLIAY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|