C11H15BrFN3O — CID 134521035
5-bromo-2-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxypyrimidine (PubChem CID 134521035) has the molecular formula C11H15BrFN3O and a molecular weight of 304.16 g/mol. Its IUPAC name is 5-bromo-2-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxypyrimidine.
| Compound Name | 5-bromo-2-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxypyrimidine |
|---|---|
| PubChem CID | 134521035 |
| Molecular Formula | C11H15BrFN3O |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 5-bromo-2-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxypyrimidine |
| SMILES | FCCCN1CC[C@H](Oc2ncc(Br)cn2)C1 |
| InChI | InChI=1S/C11H15BrFN3O/c12-9-6-14-11(15-7-9)17-10-2-5-16(8-10)4-1-3-13/h6-7,10H,1-5,8H2/t10-/m0/s1 |
| InChIKey | UWXOIGYYIAGJKD-JTQLQIEISA-N |
| XLogP | 2.05 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |