C14H20Cl2FNO — CID 154791786
3-[4-(chloromethyl)phenoxy]-1-(3-fluoropropyl)pyrrolidine;hydrochloride (PubChem CID 154791786) has the molecular formula C14H20Cl2FNO and a molecular weight of 308.22 g/mol. Its IUPAC name is 3-[4-(chloromethyl)phenoxy]-1-(3-fluoropropyl)pyrrolidine;hydrochloride.
| Compound Name | 3-[4-(chloromethyl)phenoxy]-1-(3-fluoropropyl)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 154791786 |
| Molecular Formula | C14H20Cl2FNO |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-[4-(chloromethyl)phenoxy]-1-(3-fluoropropyl)pyrrolidine;hydrochloride |
| SMILES | Cl.FCCCN1CCC(Oc2ccc(CCl)cc2)C1 |
| InChI | InChI=1S/C14H19ClFNO.ClH/c15-10-12-2-4-13(5-3-12)18-14-6-9-17(11-14)8-1-7-16;/h2-5,14H,1,6-11H2;1H |
| InChIKey | WYNOLOHIPXCRET-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|