C28H42BN3O4 — CID 174055193
3-(1-methylpyrrolidin-3-yl)oxyaniline;1-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidine (PubChem CID 174055193) has the molecular formula C28H42BN3O4 and a molecular weight of 495.47 g/mol. Its IUPAC name is 3-(1-methylpyrrolidin-3-yl)oxyaniline;1-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidine.
| Compound Name | 3-(1-methylpyrrolidin-3-yl)oxyaniline;1-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidine |
|---|---|
| PubChem CID | 174055193 |
| Molecular Formula | C28H42BN3O4 |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | 3-(1-methylpyrrolidin-3-yl)oxyaniline;1-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidine |
| SMILES | CN1CCC(Oc2cccc(B3OC(C)(C)C(C)(C)O3)c2)C1.CN1CCC(Oc2cccc(N)c2)C1 |
| InChI | InChI=1S/C17H26BNO3.C11H16N2O/c1-16(2)17(3,4)22-18(21-16)13-7-6-8-14(11-13)20-15-9-10-19(5)12-15;1-13-6-5-11(8-13)14-10-4-2-3-9(12)7-10/h6-8,11,15H,9-10,12H2,1-5H3;2-4,7,11H,5-6,8,12H2,1H3 |
| InChIKey | DACRUCBHMOSIFT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|